C15H19N2O4P — CID 141059148
[2-(4-hydroxy-3,5-dimethylphenyl)-2-(pyridin-3-ylamino)ethyl]phosphonic acid (PubChem CID 141059148) has the molecular formula C15H19N2O4P and a molecular weight of 322.30 g/mol. Its IUPAC name is [2-(4-hydroxy-3,5-dimethylphenyl)-2-(pyridin-3-ylamino)ethyl]phosphonic acid.
| Compound Name | [2-(4-hydroxy-3,5-dimethylphenyl)-2-(pyridin-3-ylamino)ethyl]phosphonic acid |
|---|---|
| PubChem CID | 141059148 |
| Molecular Formula | C15H19N2O4P |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [2-(4-hydroxy-3,5-dimethylphenyl)-2-(pyridin-3-ylamino)ethyl]phosphonic acid |
| SMILES | Cc1cc(C(CP(=O)(O)O)Nc2cccnc2)cc(C)c1O |
| InChI | InChI=1S/C15H19N2O4P/c1-10-6-12(7-11(2)15(10)18)14(9-22(19,20)21)17-13-4-3-5-16-8-13/h3-8,14,17-18H,9H2,1-2H3,(H2,19,20,21) |
| InChIKey | LNAIRJBVOREGHK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|