C17H22NO5P — CID 87871788
4-(1-dimethoxyphosphoryl-2-pyridin-3-ylethyl)-2-methoxy-6-methylphenol (PubChem CID 87871788) has the molecular formula C17H22NO5P and a molecular weight of 351.34 g/mol. Its IUPAC name is 4-(1-dimethoxyphosphoryl-2-pyridin-3-ylethyl)-2-methoxy-6-methylphenol.
| Compound Name | 4-(1-dimethoxyphosphoryl-2-pyridin-3-ylethyl)-2-methoxy-6-methylphenol |
|---|---|
| PubChem CID | 87871788 |
| Molecular Formula | C17H22NO5P |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 4-(1-dimethoxyphosphoryl-2-pyridin-3-ylethyl)-2-methoxy-6-methylphenol |
| SMILES | COc1cc(C(Cc2cccnc2)P(=O)(OC)OC)cc(C)c1O |
| InChI | InChI=1S/C17H22NO5P/c1-12-8-14(10-15(21-2)17(12)19)16(24(20,22-3)23-4)9-13-6-5-7-18-11-13/h5-8,10-11,16,19H,9H2,1-4H3 |
| InChIKey | WYVWVDSAHOIJMB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|