C19H27N2O6P — CID 15463407
4-[diethoxyphosphoryl-(pyridin-3-ylmethylamino)methyl]-2,6-dimethoxyphenol (PubChem CID 15463407) has the molecular formula C19H27N2O6P and a molecular weight of 410.41 g/mol. Its IUPAC name is 4-[diethoxyphosphoryl-(pyridin-3-ylmethylamino)methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[diethoxyphosphoryl-(pyridin-3-ylmethylamino)methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 15463407 |
| Molecular Formula | C19H27N2O6P |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-[diethoxyphosphoryl-(pyridin-3-ylmethylamino)methyl]-2,6-dimethoxyphenol |
| SMILES | CCOP(=O)(OCC)C(NCc1cccnc1)c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C19H27N2O6P/c1-5-26-28(23,27-6-2)19(21-13-14-8-7-9-20-12-14)15-10-16(24-3)18(22)17(11-15)25-4/h7-12,19,21-22H,5-6,13H2,1-4H3 |
| InChIKey | YHGMWLBDTCXJTL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|