C22H32N3O6P — CID 10389753
4-[diethoxyphosphoryl-(4-pyridin-2-ylpiperazin-1-yl)methyl]-2,6-dimethoxyphenol (PubChem CID 10389753) has the molecular formula C22H32N3O6P and a molecular weight of 465.49 g/mol. Its IUPAC name is 4-[diethoxyphosphoryl-(4-pyridin-2-ylpiperazin-1-yl)methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[diethoxyphosphoryl-(4-pyridin-2-ylpiperazin-1-yl)methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 10389753 |
| Molecular Formula | C22H32N3O6P |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 4-[diethoxyphosphoryl-(4-pyridin-2-ylpiperazin-1-yl)methyl]-2,6-dimethoxyphenol |
| SMILES | CCOP(=O)(OCC)C(c1cc(OC)c(O)c(OC)c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H32N3O6P/c1-5-30-32(27,31-6-2)22(17-15-18(28-3)21(26)19(16-17)29-4)25-13-11-24(12-14-25)20-9-7-8-10-23-20/h7-10,15-16,22,26H,5-6,11-14H2,1-4H3 |
| InChIKey | NOLVIZUKJFMBTQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 93.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|