C18H24N3O6P — CID 91549736
4-(1-diethoxyphosphoryl-2-pyrazin-2-yliminoethyl)-2,6-dimethoxyphenol (PubChem CID 91549736) has the molecular formula C18H24N3O6P and a molecular weight of 409.38 g/mol. Its IUPAC name is 4-(1-diethoxyphosphoryl-2-pyrazin-2-yliminoethyl)-2,6-dimethoxyphenol.
| Compound Name | 4-(1-diethoxyphosphoryl-2-pyrazin-2-yliminoethyl)-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 91549736 |
| Molecular Formula | C18H24N3O6P |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 4-(1-diethoxyphosphoryl-2-pyrazin-2-yliminoethyl)-2,6-dimethoxyphenol |
| SMILES | CCOP(=O)(OCC)C(/C=N/c1cnccn1)c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C18H24N3O6P/c1-5-26-28(23,27-6-2)16(11-21-17-12-19-7-8-20-17)13-9-14(24-3)18(22)15(10-13)25-4/h7-12,16,22H,5-6H2,1-4H3/b21-11+ |
| InChIKey | VLRVNFJSIZULMS-SRZZPIQSSA-N |
| XLogP | 3.91 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|