C12H20NO5P — CID 171192094
4-[(R)-amino(diethoxyphosphoryl)methyl]-3-methoxyphenol (PubChem CID 171192094) has the molecular formula C12H20NO5P and a molecular weight of 289.27 g/mol. Its IUPAC name is 4-[(R)-amino(diethoxyphosphoryl)methyl]-3-methoxyphenol.
| Compound Name | 4-[(R)-amino(diethoxyphosphoryl)methyl]-3-methoxyphenol |
|---|---|
| PubChem CID | 171192094 |
| Molecular Formula | C12H20NO5P |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-[(R)-amino(diethoxyphosphoryl)methyl]-3-methoxyphenol |
| SMILES | CCOP(=O)(OCC)[C@@H](N)c1ccc(O)cc1OC |
| InChI | InChI=1S/C12H20NO5P/c1-4-17-19(15,18-5-2)12(13)10-7-6-9(14)8-11(10)16-3/h6-8,12,14H,4-5,13H2,1-3H3/t12-/m1/s1 |
| InChIKey | QLZZPUWTRJLSET-GFCCVEGCSA-N |
| XLogP | 2.62 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|