C13H19F3NO4P — CID 171192431
(R)-diethoxyphosphoryl-[2-methoxy-4-(trifluoromethyl)phenyl]methanamine (PubChem CID 171192431) has the molecular formula C13H19F3NO4P and a molecular weight of 341.27 g/mol. Its IUPAC name is (R)-diethoxyphosphoryl-[2-methoxy-4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | (R)-diethoxyphosphoryl-[2-methoxy-4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 171192431 |
| Molecular Formula | C13H19F3NO4P |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (R)-diethoxyphosphoryl-[2-methoxy-4-(trifluoromethyl)phenyl]methanamine |
| SMILES | CCOP(=O)(OCC)[C@@H](N)c1ccc(C(F)(F)F)cc1OC |
| InChI | InChI=1S/C13H19F3NO4P/c1-4-20-22(18,21-5-2)12(17)10-7-6-9(13(14,15)16)8-11(10)19-3/h6-8,12H,4-5,17H2,1-3H3/t12-/m1/s1 |
| InChIKey | GBGTVZHSDQDLRX-GFCCVEGCSA-N |
| XLogP | 3.94 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|