C13H16F6NO3P — CID 171191850
(S)-[2,5-bis(trifluoromethyl)phenyl]-diethoxyphosphorylmethanamine (PubChem CID 171191850) has the molecular formula C13H16F6NO3P and a molecular weight of 379.24 g/mol. Its IUPAC name is (S)-[2,5-bis(trifluoromethyl)phenyl]-diethoxyphosphorylmethanamine.
| Compound Name | (S)-[2,5-bis(trifluoromethyl)phenyl]-diethoxyphosphorylmethanamine |
|---|---|
| PubChem CID | 171191850 |
| Molecular Formula | C13H16F6NO3P |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | (S)-[2,5-bis(trifluoromethyl)phenyl]-diethoxyphosphorylmethanamine |
| SMILES | CCOP(=O)(OCC)[C@H](N)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C13H16F6NO3P/c1-3-22-24(21,23-4-2)11(20)9-7-8(12(14,15)16)5-6-10(9)13(17,18)19/h5-7,11H,3-4,20H2,1-2H3/t11-/m0/s1 |
| InChIKey | CFDXLTLNRNQIOO-NSHDSACASA-N |
| XLogP | 4.95 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|