C12H17F3NO3P — CID 171192056
(R)-diethoxyphosphoryl-[4-(trifluoromethyl)phenyl]methanamine (PubChem CID 171192056) has the molecular formula C12H17F3NO3P and a molecular weight of 311.24 g/mol. Its IUPAC name is (R)-diethoxyphosphoryl-[4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | (R)-diethoxyphosphoryl-[4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 171192056 |
| Molecular Formula | C12H17F3NO3P |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | (R)-diethoxyphosphoryl-[4-(trifluoromethyl)phenyl]methanamine |
| SMILES | CCOP(=O)(OCC)[C@@H](N)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H17F3NO3P/c1-3-18-20(17,19-4-2)11(16)9-5-7-10(8-6-9)12(13,14)15/h5-8,11H,3-4,16H2,1-2H3/t11-/m1/s1 |
| InChIKey | WTVFQRLVBGSDFM-LLVKDONJSA-N |
| XLogP | 3.93 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|