C22H33F3NO6P — CID 174214416
tert-butyl 2-diethoxyphosphoryl-3-methyl-4-oxo-4-[1-[4-(trifluoromethyl)phenyl]ethylamino]butanoate (PubChem CID 174214416) has the molecular formula C22H33F3NO6P and a molecular weight of 495.48 g/mol. Its IUPAC name is tert-butyl 2-diethoxyphosphoryl-3-methyl-4-oxo-4-[1-[4-(trifluoromethyl)phenyl]ethylamino]butanoate.
| Compound Name | tert-butyl 2-diethoxyphosphoryl-3-methyl-4-oxo-4-[1-[4-(trifluoromethyl)phenyl]ethylamino]butanoate |
|---|---|
| PubChem CID | 174214416 |
| Molecular Formula | C22H33F3NO6P |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | tert-butyl 2-diethoxyphosphoryl-3-methyl-4-oxo-4-[1-[4-(trifluoromethyl)phenyl]ethylamino]butanoate |
| SMILES | CCOP(=O)(OCC)C(C(=O)OC(C)(C)C)C(C)C(=O)NC(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H33F3NO6P/c1-8-30-33(29,31-9-2)18(20(28)32-21(5,6)7)14(3)19(27)26-15(4)16-10-12-17(13-11-16)22(23,24)25/h10-15,18H,8-9H2,1-7H3,(H,26,27) |
| InChIKey | PMOMXYNWCOLMBI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|