C23H34F3N2O7P — CID 166098865
2-morpholin-4-ylethyl 2-diethoxyphosphoryl-4-oxo-4-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]butanoate (PubChem CID 166098865) has the molecular formula C23H34F3N2O7P and a molecular weight of 538.50 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 2-diethoxyphosphoryl-4-oxo-4-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]butanoate.
| Compound Name | 2-morpholin-4-ylethyl 2-diethoxyphosphoryl-4-oxo-4-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]butanoate |
|---|---|
| PubChem CID | 166098865 |
| Molecular Formula | C23H34F3N2O7P |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 2-morpholin-4-ylethyl 2-diethoxyphosphoryl-4-oxo-4-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]butanoate |
| SMILES | CCOP(=O)(OCC)C(CC(=O)N[C@@H](C)c1ccc(C(F)(F)F)cc1)C(=O)OCCN1CCOCC1 |
| InChI | InChI=1S/C23H34F3N2O7P/c1-4-34-36(31,35-5-2)20(22(30)33-15-12-28-10-13-32-14-11-28)16-21(29)27-17(3)18-6-8-19(9-7-18)23(24,25)26/h6-9,17,20H,4-5,10-16H2,1-3H3,(H,27,29)/t17-,20?/m0/s1 |
| InChIKey | CLIDITIKDHSHEE-DIMJTDRSSA-N |
| XLogP | 3.78 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|