C23H34F3N2O6P — CID 174227415
(1-methylpiperidin-4-yl) 2-diethoxyphosphoryl-4-oxo-4-[1-[4-(trifluoromethyl)phenyl]ethylamino]butanoate (PubChem CID 174227415) has the molecular formula C23H34F3N2O6P and a molecular weight of 522.50 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 2-diethoxyphosphoryl-4-oxo-4-[1-[4-(trifluoromethyl)phenyl]ethylamino]butanoate.
| Compound Name | (1-methylpiperidin-4-yl) 2-diethoxyphosphoryl-4-oxo-4-[1-[4-(trifluoromethyl)phenyl]ethylamino]butanoate |
|---|---|
| PubChem CID | 174227415 |
| Molecular Formula | C23H34F3N2O6P |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | (1-methylpiperidin-4-yl) 2-diethoxyphosphoryl-4-oxo-4-[1-[4-(trifluoromethyl)phenyl]ethylamino]butanoate |
| SMILES | CCOP(=O)(OCC)C(CC(=O)NC(C)c1ccc(C(F)(F)F)cc1)C(=O)OC1CCN(C)CC1 |
| InChI | InChI=1S/C23H34F3N2O6P/c1-5-32-35(31,33-6-2)20(22(30)34-19-11-13-28(4)14-12-19)15-21(29)27-16(3)17-7-9-18(10-8-17)23(24,25)26/h7-10,16,19-20H,5-6,11-15H2,1-4H3,(H,27,29) |
| InChIKey | WSQCFQDUKXKEJC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|