C20H32BrO5P — CID 102030596
tert-butyl 3-(4-bromophenyl)-2-diethoxyphosphorylhexanoate (PubChem CID 102030596) has the molecular formula C20H32BrO5P and a molecular weight of 463.35 g/mol. Its IUPAC name is tert-butyl 3-(4-bromophenyl)-2-diethoxyphosphorylhexanoate.
| Compound Name | tert-butyl 3-(4-bromophenyl)-2-diethoxyphosphorylhexanoate |
|---|---|
| PubChem CID | 102030596 |
| Molecular Formula | C20H32BrO5P |
| Molecular Weight | 463.35 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | tert-butyl 3-(4-bromophenyl)-2-diethoxyphosphorylhexanoate |
| SMILES | CCCC(c1ccc(Br)cc1)C(C(=O)OC(C)(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C20H32BrO5P/c1-7-10-17(15-11-13-16(21)14-12-15)18(19(22)26-20(4,5)6)27(23,24-8-2)25-9-3/h11-14,17-18H,7-10H2,1-6H3 |
| InChIKey | COJRFFXBKWHFLK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.35 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|