C16H24BrNO2S — CID 116686938
tert-butyl 2-[2-amino-1-(4-bromophenyl)butyl]sulfanylacetate (PubChem CID 116686938) has the molecular formula C16H24BrNO2S and a molecular weight of 374.34 g/mol. Its IUPAC name is tert-butyl 2-[2-amino-1-(4-bromophenyl)butyl]sulfanylacetate.
| Compound Name | tert-butyl 2-[2-amino-1-(4-bromophenyl)butyl]sulfanylacetate |
|---|---|
| PubChem CID | 116686938 |
| Molecular Formula | C16H24BrNO2S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | tert-butyl 2-[2-amino-1-(4-bromophenyl)butyl]sulfanylacetate |
| SMILES | CCC(N)C(SCC(=O)OC(C)(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H24BrNO2S/c1-5-13(18)15(11-6-8-12(17)9-7-11)21-10-14(19)20-16(2,3)4/h6-9,13,15H,5,10,18H2,1-4H3 |
| InChIKey | AZMCOZSZKGNWBA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |