C14H22BrIN3O5P — CID 134205770
tert-butyl 2-[(3-bromo-5-iodopyrazin-2-yl)amino]-2-diethoxyphosphorylacetate (PubChem CID 134205770) has the molecular formula C14H22BrIN3O5P and a molecular weight of 550.13 g/mol. Its IUPAC name is tert-butyl 2-[(3-bromo-5-iodopyrazin-2-yl)amino]-2-diethoxyphosphorylacetate.
| Compound Name | tert-butyl 2-[(3-bromo-5-iodopyrazin-2-yl)amino]-2-diethoxyphosphorylacetate |
|---|---|
| PubChem CID | 134205770 |
| Molecular Formula | C14H22BrIN3O5P |
| Molecular Weight | 550.13 g/mol |
| Exact Mass | 548.95 |
| IUPAC Name | tert-butyl 2-[(3-bromo-5-iodopyrazin-2-yl)amino]-2-diethoxyphosphorylacetate |
| SMILES | CCOP(=O)(OCC)C(Nc1ncc(I)nc1Br)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22BrIN3O5P/c1-6-22-25(21,23-7-2)12(13(20)24-14(3,4)5)19-11-10(15)18-9(16)8-17-11/h8,12H,6-7H2,1-5H3,(H,17,19) |
| InChIKey | ZXUQCTZOPGCXQE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.13 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|