C20H37N2O6P — CID 156537694
tert-butyl 2-diethoxyphosphoryl-3-(3-heptyl-1,2,4-oxadiazol-5-yl)propanoate (PubChem CID 156537694) has the molecular formula C20H37N2O6P and a molecular weight of 432.50 g/mol. Its IUPAC name is tert-butyl 2-diethoxyphosphoryl-3-(3-heptyl-1,2,4-oxadiazol-5-yl)propanoate.
| Compound Name | tert-butyl 2-diethoxyphosphoryl-3-(3-heptyl-1,2,4-oxadiazol-5-yl)propanoate |
|---|---|
| PubChem CID | 156537694 |
| Molecular Formula | C20H37N2O6P |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | tert-butyl 2-diethoxyphosphoryl-3-(3-heptyl-1,2,4-oxadiazol-5-yl)propanoate |
| SMILES | CCCCCCCc1noc(CC(C(=O)OC(C)(C)C)P(=O)(OCC)OCC)n1 |
| InChI | InChI=1S/C20H37N2O6P/c1-7-10-11-12-13-14-17-21-18(28-22-17)15-16(19(23)27-20(4,5)6)29(24,25-8-2)26-9-3/h16H,7-15H2,1-6H3 |
| InChIKey | STQHFVBSCPYOKE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|