C21H41N2O7P — CID 156545678
tert-butyl 2-diethoxyphosphoryl-4-(2-nonanoylhydrazinyl)-4-oxobutanoate (PubChem CID 156545678) has the molecular formula C21H41N2O7P and a molecular weight of 464.54 g/mol. Its IUPAC name is tert-butyl 2-diethoxyphosphoryl-4-(2-nonanoylhydrazinyl)-4-oxobutanoate.
| Compound Name | tert-butyl 2-diethoxyphosphoryl-4-(2-nonanoylhydrazinyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 156545678 |
| Molecular Formula | C21H41N2O7P |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | tert-butyl 2-diethoxyphosphoryl-4-(2-nonanoylhydrazinyl)-4-oxobutanoate |
| SMILES | CCCCCCCCC(=O)NNC(=O)CC(C(=O)OC(C)(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C21H41N2O7P/c1-7-10-11-12-13-14-15-18(24)22-23-19(25)16-17(20(26)30-21(4,5)6)31(27,28-8-2)29-9-3/h17H,7-16H2,1-6H3,(H,22,24)(H,23,25) |
| InChIKey | SKPRHGNGODCURG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|