C24H39N2O6P — CID 156800073
tert-butyl 2-diethoxyphosphoryl-3-[3-[(4-ethylphenyl)methyl]-1,2,4-oxadiazol-5-yl]propanoate;ethane (PubChem CID 156800073) has the molecular formula C24H39N2O6P and a molecular weight of 482.56 g/mol. Its IUPAC name is tert-butyl 2-diethoxyphosphoryl-3-[3-[(4-ethylphenyl)methyl]-1,2,4-oxadiazol-5-yl]propanoate;ethane.
| Compound Name | tert-butyl 2-diethoxyphosphoryl-3-[3-[(4-ethylphenyl)methyl]-1,2,4-oxadiazol-5-yl]propanoate;ethane |
|---|---|
| PubChem CID | 156800073 |
| Molecular Formula | C24H39N2O6P |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | tert-butyl 2-diethoxyphosphoryl-3-[3-[(4-ethylphenyl)methyl]-1,2,4-oxadiazol-5-yl]propanoate;ethane |
| SMILES | CC.CCOP(=O)(OCC)C(Cc1nc(Cc2ccc(CC)cc2)no1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33N2O6P.C2H6/c1-7-16-10-12-17(13-11-16)14-19-23-20(30-24-19)15-18(21(25)29-22(4,5)6)31(26,27-8-2)28-9-3;1-2/h10-13,18H,7-9,14-15H2,1-6H3;1-2H3 |
| InChIKey | QLUCBAVCFCDPPP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|