C23H49BrO9P2 — CID 159212974
tert-butyl 2-bromopropanoate;tert-butyl 2-diethoxyphosphorylpropanoate;diethoxy(methyl)phosphane (PubChem CID 159212974) has the molecular formula C23H49BrO9P2 and a molecular weight of 611.49 g/mol. Its IUPAC name is tert-butyl 2-bromopropanoate;tert-butyl 2-diethoxyphosphorylpropanoate;diethoxy(methyl)phosphane.
| Compound Name | tert-butyl 2-bromopropanoate;tert-butyl 2-diethoxyphosphorylpropanoate;diethoxy(methyl)phosphane |
|---|---|
| PubChem CID | 159212974 |
| Molecular Formula | C23H49BrO9P2 |
| Molecular Weight | 611.49 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | tert-butyl 2-bromopropanoate;tert-butyl 2-diethoxyphosphorylpropanoate;diethoxy(methyl)phosphane |
| SMILES | CC(Br)C(=O)OC(C)(C)C.CCOP(=O)(OCC)C(C)C(=O)OC(C)(C)C.CCOP(C)OCC |
| InChI | InChI=1S/C11H23O5P.C7H13BrO2.C5H13O2P/c1-7-14-17(13,15-8-2)9(3)10(12)16-11(4,5)6;1-5(8)6(9)10-7(2,3)4;1-4-6-8(3)7-5-2/h9H,7-8H2,1-6H3;5H,1-4H3;4-5H2,1-3H3 |
| InChIKey | KQSPGKXLDRWWHR-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.49 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|