C17H37NO8P2 — CID 135014585
tert-butyl (2R)-2-amino-4,4-bis(diethoxyphosphoryl)-2-methylbutanoate (PubChem CID 135014585) has the molecular formula C17H37NO8P2 and a molecular weight of 445.43 g/mol. Its IUPAC name is tert-butyl (2R)-2-amino-4,4-bis(diethoxyphosphoryl)-2-methylbutanoate.
| Compound Name | tert-butyl (2R)-2-amino-4,4-bis(diethoxyphosphoryl)-2-methylbutanoate |
|---|---|
| PubChem CID | 135014585 |
| Molecular Formula | C17H37NO8P2 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | tert-butyl (2R)-2-amino-4,4-bis(diethoxyphosphoryl)-2-methylbutanoate |
| SMILES | CCOP(=O)(OCC)C(C[C@@](C)(N)C(=O)OC(C)(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H37NO8P2/c1-9-22-27(20,23-10-2)14(28(21,24-11-3)25-12-4)13-17(8,18)15(19)26-16(5,6)7/h14H,9-13,18H2,1-8H3/t17-/m1/s1 |
| InChIKey | VNOMQLHNTCSAFZ-QGZVFWFLSA-N |
| XLogP | 4.29 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|