About tert-butyl 2-amino-2,2-diethoxyacetate
tert-butyl 2-amino-2,2-diethoxyacetate (PubChem CID 87520437) has the molecular formula C10H21NO4
and a molecular weight of 219.28 g/mol. Its IUPAC name is tert-butyl 2-amino-2,2-diethoxyacetate.
Molecular Properties
| Compound Name | tert-butyl 2-amino-2,2-diethoxyacetate |
| PubChem CID | 87520437 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | tert-butyl 2-amino-2,2-diethoxyacetate |
| SMILES | CCOC(N)(OCC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H21NO4/c1-6-13-10(11,14-7-2)8(12)15-9(3,4)5/h6-7,11H2,1-5H3 |
| InChIKey | JHAWCVXENXZOPX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-amino-2,2-diethoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-amino-2,2-diethoxyacetate?
The IUPAC name of tert-butyl 2-amino-2,2-diethoxyacetate (CID 87520437) is tert-butyl 2-amino-2,2-diethoxyacetate.
What is the SMILES notation for tert-butyl 2-amino-2,2-diethoxyacetate?
The canonical SMILES for tert-butyl 2-amino-2,2-diethoxyacetate is CCOC(N)(OCC)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-amino-2,2-diethoxyacetate?
The InChIKey is JHAWCVXENXZOPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO4/c1-6-13-10(11,14-7-2)8(12)15-9(3,4)5/h6-7,11H2,1-5H3.
What are the key properties of tert-butyl 2-amino-2,2-diethoxyacetate?
tert-butyl 2-amino-2,2-diethoxyacetate has a molecular weight of 219.28 g/mol, XLogP of 1.01, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-amino-2,2-diethoxyacetate is sourced from PubChem (CID 87520437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).