C12H25NO3 — CID 166066417
tert-butyl (2R)-2-amino-2-methyl-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 166066417) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is tert-butyl (2R)-2-amino-2-methyl-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | tert-butyl (2R)-2-amino-2-methyl-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 166066417 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | tert-butyl (2R)-2-amino-2-methyl-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | CC(C)(C)OC[C@@](C)(N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H25NO3/c1-10(2,3)15-8-12(7,13)9(14)16-11(4,5)6/h8,13H2,1-7H3/t12-/m1/s1 |
| InChIKey | LTAUCGSGLYAULJ-GFCCVEGCSA-N |
| XLogP | 1.86 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |