About tert-butyl 2-amino-2-methyl-3-propanoylperoxypropanoate
tert-butyl 2-amino-2-methyl-3-propanoylperoxypropanoate (PubChem CID 175589299) has the molecular formula C11H21NO5
and a molecular weight of 247.29 g/mol. Its IUPAC name is tert-butyl 2-amino-2-methyl-3-propanoylperoxypropanoate.
Molecular Properties
| Compound Name | tert-butyl 2-amino-2-methyl-3-propanoylperoxypropanoate |
| PubChem CID | 175589299 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | tert-butyl 2-amino-2-methyl-3-propanoylperoxypropanoate |
| SMILES | CCC(=O)OOCC(C)(N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO5/c1-6-8(13)17-15-7-11(5,12)9(14)16-10(2,3)4/h6-7,12H2,1-5H3 |
| InChIKey | KXNZRKHVWOICHZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-amino-2-methyl-3-propanoylperoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-amino-2-methyl-3-propanoylperoxypropanoate?
The IUPAC name of tert-butyl 2-amino-2-methyl-3-propanoylperoxypropanoate (CID 175589299) is tert-butyl 2-amino-2-methyl-3-propanoylperoxypropanoate.
What is the SMILES notation for tert-butyl 2-amino-2-methyl-3-propanoylperoxypropanoate?
The canonical SMILES for tert-butyl 2-amino-2-methyl-3-propanoylperoxypropanoate is CCC(=O)OOCC(C)(N)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-amino-2-methyl-3-propanoylperoxypropanoate?
The InChIKey is KXNZRKHVWOICHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO5/c1-6-8(13)17-15-7-11(5,12)9(14)16-10(2,3)4/h6-7,12H2,1-5H3.
What are the key properties of tert-butyl 2-amino-2-methyl-3-propanoylperoxypropanoate?
tert-butyl 2-amino-2-methyl-3-propanoylperoxypropanoate has a molecular weight of 247.29 g/mol, XLogP of 0.93, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-amino-2-methyl-3-propanoylperoxypropanoate is sourced from PubChem (CID 175589299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).