C11H21NO2 — CID 90204397
tert-butyl 2-amino-3-cyclopropyl-2-methylpropanoate (PubChem CID 90204397) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is tert-butyl 2-amino-3-cyclopropyl-2-methylpropanoate.
| Compound Name | tert-butyl 2-amino-3-cyclopropyl-2-methylpropanoate |
|---|---|
| PubChem CID | 90204397 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | tert-butyl 2-amino-3-cyclopropyl-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(N)CC1CC1 |
| InChI | InChI=1S/C11H21NO2/c1-10(2,3)14-9(13)11(4,12)7-8-5-6-8/h8H,5-7,12H2,1-4H3 |
| InChIKey | MXZUGKSTHPGUDO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |