C24H44N2O8S2 — CID 165146605
ditert-butyl 2-amino-2-[[[2-amino-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxopropyl]disulfanyl]methyl]propanedioate (PubChem CID 165146605) has the molecular formula C24H44N2O8S2 and a molecular weight of 552.76 g/mol. Its IUPAC name is ditert-butyl 2-amino-2-[[[2-amino-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxopropyl]disulfanyl]methyl]propanedioate.
| Compound Name | ditert-butyl 2-amino-2-[[[2-amino-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxopropyl]disulfanyl]methyl]propanedioate |
|---|---|
| PubChem CID | 165146605 |
| Molecular Formula | C24H44N2O8S2 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | ditert-butyl 2-amino-2-[[[2-amino-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxopropyl]disulfanyl]methyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(N)(CSSCC(N)(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H44N2O8S2/c1-19(2,3)31-15(27)23(25,16(28)32-20(4,5)6)13-35-36-14-24(26,17(29)33-21(7,8)9)18(30)34-22(10,11)12/h13-14,25-26H2,1-12H3 |
| InChIKey | IRNRNEIXKAAKSR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 157.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|