C8H16N2O4 — CID 139899939
tert-butyl (2S)-2,3-diamino-2-(hydroxymethyl)-3-oxopropanoate (PubChem CID 139899939) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is tert-butyl (2S)-2,3-diamino-2-(hydroxymethyl)-3-oxopropanoate.
| Compound Name | tert-butyl (2S)-2,3-diamino-2-(hydroxymethyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 139899939 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | tert-butyl (2S)-2,3-diamino-2-(hydroxymethyl)-3-oxopropanoate |
| SMILES | CC(C)(C)OC(=O)[C@](N)(CO)C(N)=O |
| InChI | InChI=1S/C8H16N2O4/c1-7(2,3)14-6(13)8(10,4-11)5(9)12/h11H,4,10H2,1-3H3,(H2,9,12)/t8-/m0/s1 |
| InChIKey | JVTJLHOSIMMUNY-QMMMGPOBSA-N |
| XLogP | -1.50 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|