C12H23NO4 — CID 142841026
3-O-tert-butyl 1-O-methyl 2-amino-2-(2-methylpropyl)propanedioate (PubChem CID 142841026) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl 2-amino-2-(2-methylpropyl)propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-methyl 2-amino-2-(2-methylpropyl)propanedioate |
|---|---|
| PubChem CID | 142841026 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl 2-amino-2-(2-methylpropyl)propanedioate |
| SMILES | COC(=O)C(N)(CC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23NO4/c1-8(2)7-12(13,9(14)16-6)10(15)17-11(3,4)5/h8H,7,13H2,1-6H3 |
| InChIKey | QLOARUFQIIDZPG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|