C11H17F2NO4 — CID 118278395
3-O-tert-butyl 1-O-methyl (2S)-2-amino-2-(3,3-difluoroprop-2-enyl)propanedioate (PubChem CID 118278395) has the molecular formula C11H17F2NO4 and a molecular weight of 265.26 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl (2S)-2-amino-2-(3,3-difluoroprop-2-enyl)propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-methyl (2S)-2-amino-2-(3,3-difluoroprop-2-enyl)propanedioate |
|---|---|
| PubChem CID | 118278395 |
| Molecular Formula | C11H17F2NO4 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl (2S)-2-amino-2-(3,3-difluoroprop-2-enyl)propanedioate |
| SMILES | COC(=O)[C@@](N)(CC=C(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H17F2NO4/c1-10(2,3)18-9(16)11(14,8(15)17-4)6-5-7(12)13/h5H,6,14H2,1-4H3/t11-/m0/s1 |
| InChIKey | HXJQLSBAOOIZIV-NSHDSACASA-N |
| XLogP | 1.37 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|