About 3-O-tert-butyl 1-O-methyl (2R)-2-ethyl-2-fluoropropanedioate
3-O-tert-butyl 1-O-methyl (2R)-2-ethyl-2-fluoropropanedioate (PubChem CID 25265204) has the molecular formula C10H17FO4
and a molecular weight of 220.24 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl (2R)-2-ethyl-2-fluoropropanedioate.
Molecular Properties
| Compound Name | 3-O-tert-butyl 1-O-methyl (2R)-2-ethyl-2-fluoropropanedioate |
| PubChem CID | 25265204 |
| Molecular Formula | C10H17FO4 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl (2R)-2-ethyl-2-fluoropropanedioate |
| SMILES | CC[C@@](F)(C(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H17FO4/c1-6-10(11,7(12)14-5)8(13)15-9(2,3)4/h6H2,1-5H3/t10-/m1/s1 |
| InChIKey | BLPFSOBXIRMONT-SNVBAGLBSA-N |
| XLogP | 1.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-O-tert-butyl 1-O-methyl (2R)-2-ethyl-2-fluoropropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-tert-butyl 1-O-methyl (2R)-2-ethyl-2-fluoropropanedioate?
The IUPAC name of 3-O-tert-butyl 1-O-methyl (2R)-2-ethyl-2-fluoropropanedioate (CID 25265204) is 3-O-tert-butyl 1-O-methyl (2R)-2-ethyl-2-fluoropropanedioate.
What is the SMILES notation for 3-O-tert-butyl 1-O-methyl (2R)-2-ethyl-2-fluoropropanedioate?
The canonical SMILES for 3-O-tert-butyl 1-O-methyl (2R)-2-ethyl-2-fluoropropanedioate is CC[C@@](F)(C(=O)OC)C(=O)OC(C)(C)C.
What is the InChIKey of 3-O-tert-butyl 1-O-methyl (2R)-2-ethyl-2-fluoropropanedioate?
The InChIKey is BLPFSOBXIRMONT-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H17FO4/c1-6-10(11,7(12)14-5)8(13)15-9(2,3)4/h6H2,1-5H3/t10-/m1/s1.
What are the key properties of 3-O-tert-butyl 1-O-methyl (2R)-2-ethyl-2-fluoropropanedioate?
3-O-tert-butyl 1-O-methyl (2R)-2-ethyl-2-fluoropropanedioate has a molecular weight of 220.24 g/mol, XLogP of 1.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-tert-butyl 1-O-methyl (2R)-2-ethyl-2-fluoropropanedioate is sourced from PubChem (CID 25265204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).