C16H30O3 — CID 89223123
tert-butyl 2-ethyl-5-methoxy-2,4,4-trimethylhex-5-enoate (PubChem CID 89223123) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is tert-butyl 2-ethyl-5-methoxy-2,4,4-trimethylhex-5-enoate.
| Compound Name | tert-butyl 2-ethyl-5-methoxy-2,4,4-trimethylhex-5-enoate |
|---|---|
| PubChem CID | 89223123 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | tert-butyl 2-ethyl-5-methoxy-2,4,4-trimethylhex-5-enoate |
| SMILES | C=C(OC)C(C)(C)CC(C)(CC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30O3/c1-10-16(8,13(17)19-14(3,4)5)11-15(6,7)12(2)18-9/h2,10-11H2,1,3-9H3 |
| InChIKey | NKYYULZHPKDCOY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|