C37H76O8Si4 — CID 18684368
4-methoxycarbonyl-2,4,6,6-tetramethyl-2-[2-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butyl]-7-[2-methyl-4-tris(trimethylsilyl)silylbutan-2-yl]oxy-7-oxoheptanoic acid (PubChem CID 18684368) has the molecular formula C37H76O8Si4 and a molecular weight of 761.35 g/mol. Its IUPAC name is 4-methoxycarbonyl-2,4,6,6-tetramethyl-2-[2-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butyl]-7-[2-methyl-4-tris(trimethylsilyl)silylbutan-2-yl]oxy-7-oxoheptanoic acid.
| Compound Name | 4-methoxycarbonyl-2,4,6,6-tetramethyl-2-[2-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butyl]-7-[2-methyl-4-tris(trimethylsilyl)silylbutan-2-yl]oxy-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 18684368 |
| Molecular Formula | C37H76O8Si4 |
| Molecular Weight | 761.35 g/mol |
| Exact Mass | 760.46 |
| IUPAC Name | 4-methoxycarbonyl-2,4,6,6-tetramethyl-2-[2-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butyl]-7-[2-methyl-4-tris(trimethylsilyl)silylbutan-2-yl]oxy-7-oxoheptanoic acid |
| SMILES | CCC(C)(CC(C)(CC(C)(CC(C)(C)C(=O)OC(C)(C)CC[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)C(=O)OC)C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H76O8Si4/c1-22-35(9,31(42)44-32(2,3)4)26-36(10,28(38)39)27-37(11,30(41)43-12)25-33(5,6)29(40)45-34(7,8)23-24-49(46(13,14)15,47(16,17)18)48(19,20)21/h22-27H2,1-21H3,(H,38,39) |
| InChIKey | BSVMIQXORJALHW-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.35 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|