About 3-O-tert-butyl 1-O-methyl 2-hydroxy-2-propylpropanedioate
3-O-tert-butyl 1-O-methyl 2-hydroxy-2-propylpropanedioate (PubChem CID 154080063) has the molecular formula C11H20O5
and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-methyl 2-hydroxy-2-propylpropanedioate.
Molecular Properties
| Compound Name | 3-O-tert-butyl 1-O-methyl 2-hydroxy-2-propylpropanedioate |
| PubChem CID | 154080063 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 3-O-tert-butyl 1-O-methyl 2-hydroxy-2-propylpropanedioate |
| SMILES | CCCC(O)(C(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H20O5/c1-6-7-11(14,8(12)15-5)9(13)16-10(2,3)4/h14H,6-7H2,1-5H3 |
| InChIKey | JBWXFZGQNXBJJO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-O-tert-butyl 1-O-methyl 2-hydroxy-2-propylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-tert-butyl 1-O-methyl 2-hydroxy-2-propylpropanedioate?
The IUPAC name of 3-O-tert-butyl 1-O-methyl 2-hydroxy-2-propylpropanedioate (CID 154080063) is 3-O-tert-butyl 1-O-methyl 2-hydroxy-2-propylpropanedioate.
What is the SMILES notation for 3-O-tert-butyl 1-O-methyl 2-hydroxy-2-propylpropanedioate?
The canonical SMILES for 3-O-tert-butyl 1-O-methyl 2-hydroxy-2-propylpropanedioate is CCCC(O)(C(=O)OC)C(=O)OC(C)(C)C.
What is the InChIKey of 3-O-tert-butyl 1-O-methyl 2-hydroxy-2-propylpropanedioate?
The InChIKey is JBWXFZGQNXBJJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O5/c1-6-7-11(14,8(12)15-5)9(13)16-10(2,3)4/h14H,6-7H2,1-5H3.
What are the key properties of 3-O-tert-butyl 1-O-methyl 2-hydroxy-2-propylpropanedioate?
3-O-tert-butyl 1-O-methyl 2-hydroxy-2-propylpropanedioate has a molecular weight of 232.28 g/mol, XLogP of 1.03, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-tert-butyl 1-O-methyl 2-hydroxy-2-propylpropanedioate is sourced from PubChem (CID 154080063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).