methyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate

C6H13NO2S — CID 45086744

IUPACmethyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate
SMILESCOC(=O)[C@@](C)(N)CSC
InChIInChI=1S/C6H13NO2S/c1-6(7,4-10-3)5(8)9-2/h4,7H2,1-3H3/t6-/m0/s1
InChIKeyNEDPEFGKQWKCJW-LURJTMIESA-N
MW163.24 g/mol
LogP0.24
Rot. Bonds3

About methyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate

methyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate (PubChem CID 45086744) has the molecular formula C6H13NO2S and a molecular weight of 163.24 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate.

Molecular Properties

Compound Namemethyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate
PubChem CID45086744
Molecular FormulaC6H13NO2S
Molecular Weight163.24 g/mol
Exact Mass163.07
IUPAC Namemethyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate
SMILESCOC(=O)[C@@](C)(N)CSC
InChIInChI=1S/C6H13NO2S/c1-6(7,4-10-3)5(8)9-2/h4,7H2,1-3H3/t6-/m0/s1
InChIKeyNEDPEFGKQWKCJW-LURJTMIESA-N
XLogP0.24
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.24
LogP ≤ 50.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate?
The IUPAC name of methyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate (CID 45086744) is methyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate.
What is the SMILES notation for methyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate?
The canonical SMILES for methyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate is COC(=O)[C@@](C)(N)CSC.
What is the InChIKey of methyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate?
The InChIKey is NEDPEFGKQWKCJW-LURJTMIESA-N. The full InChI is InChI=1S/C6H13NO2S/c1-6(7,4-10-3)5(8)9-2/h4,7H2,1-3H3/t6-/m0/s1.
What are the key properties of methyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate?
methyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate has a molecular weight of 163.24 g/mol, XLogP of 0.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-amino-2-methyl-3-methylsulfanylpropanoate is sourced from PubChem (CID 45086744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).