About methyl (2S)-2-amino-3-hydroxy-2-methylpropanoate;thionyl dichloride;hydrochloride
methyl (2S)-2-amino-3-hydroxy-2-methylpropanoate;thionyl dichloride;hydrochloride (PubChem CID 159097335) has the molecular formula C5H12Cl3NO4S
and a molecular weight of 288.58 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-hydroxy-2-methylpropanoate;thionyl dichloride;hydrochloride.
Molecular Properties
| Compound Name | methyl (2S)-2-amino-3-hydroxy-2-methylpropanoate;thionyl dichloride;hydrochloride |
| PubChem CID | 159097335 |
| Molecular Formula | C5H12Cl3NO4S |
| Molecular Weight | 288.58 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | methyl (2S)-2-amino-3-hydroxy-2-methylpropanoate;thionyl dichloride;hydrochloride |
| SMILES | COC(=O)[C@@](C)(N)CO.Cl.O=S(Cl)Cl |
| InChI | InChI=1S/C5H11NO3.Cl2OS.ClH/c1-5(6,3-7)4(8)9-2;1-4(2)3;/h7H,3,6H2,1-2H3;;1H/t5-;;/m0../s1 |
| InChIKey | KCVHYJQBAVOYJW-XRIGFGBMSA-N |
| XLogP | 0.33 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.58 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2S)-2-amino-3-hydroxy-2-methylpropanoate;thionyl dichloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-amino-3-hydroxy-2-methylpropanoate;thionyl dichloride;hydrochloride?
The IUPAC name of methyl (2S)-2-amino-3-hydroxy-2-methylpropanoate;thionyl dichloride;hydrochloride (CID 159097335) is methyl (2S)-2-amino-3-hydroxy-2-methylpropanoate;thionyl dichloride;hydrochloride.
What is the SMILES notation for methyl (2S)-2-amino-3-hydroxy-2-methylpropanoate;thionyl dichloride;hydrochloride?
The canonical SMILES for methyl (2S)-2-amino-3-hydroxy-2-methylpropanoate;thionyl dichloride;hydrochloride is COC(=O)[C@@](C)(N)CO.Cl.O=S(Cl)Cl.
What is the InChIKey of methyl (2S)-2-amino-3-hydroxy-2-methylpropanoate;thionyl dichloride;hydrochloride?
The InChIKey is KCVHYJQBAVOYJW-XRIGFGBMSA-N. The full InChI is InChI=1S/C5H11NO3.Cl2OS.ClH/c1-5(6,3-7)4(8)9-2;1-4(2)3;/h7H,3,6H2,1-2H3;;1H/t5-;;/m0../s1.
What are the key properties of methyl (2S)-2-amino-3-hydroxy-2-methylpropanoate;thionyl dichloride;hydrochloride?
methyl (2S)-2-amino-3-hydroxy-2-methylpropanoate;thionyl dichloride;hydrochloride has a molecular weight of 288.58 g/mol, XLogP of 0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-amino-3-hydroxy-2-methylpropanoate;thionyl dichloride;hydrochloride is sourced from PubChem (CID 159097335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).