C10H21NO2S — CID 107755651
methyl 2-amino-2-methyl-3-(3-methylbutan-2-ylsulfanyl)propanoate (PubChem CID 107755651) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is methyl 2-amino-2-methyl-3-(3-methylbutan-2-ylsulfanyl)propanoate.
| Compound Name | methyl 2-amino-2-methyl-3-(3-methylbutan-2-ylsulfanyl)propanoate |
|---|---|
| PubChem CID | 107755651 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | methyl 2-amino-2-methyl-3-(3-methylbutan-2-ylsulfanyl)propanoate |
| SMILES | COC(=O)C(C)(N)CSC(C)C(C)C |
| InChI | InChI=1S/C10H21NO2S/c1-7(2)8(3)14-6-10(4,11)9(12)13-5/h7-8H,6,11H2,1-5H3 |
| InChIKey | UIVGCYYAHCYXCH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |