C10H21NO2S — CID 107755874
2-amino-2-methyl-4-(3-methylbutan-2-ylsulfanyl)butanoic acid (PubChem CID 107755874) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is 2-amino-2-methyl-4-(3-methylbutan-2-ylsulfanyl)butanoic acid.
| Compound Name | 2-amino-2-methyl-4-(3-methylbutan-2-ylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 107755874 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-amino-2-methyl-4-(3-methylbutan-2-ylsulfanyl)butanoic acid |
| SMILES | CC(C)C(C)SCCC(C)(N)C(=O)O |
| InChI | InChI=1S/C10H21NO2S/c1-7(2)8(3)14-6-5-10(4,11)9(12)13/h7-8H,5-6,11H2,1-4H3,(H,12,13) |
| InChIKey | YYRBPSJDERLXMS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |