C10H21NO3S — CID 107771732
methyl 3-(3-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(methylamino)propanoate (PubChem CID 107771732) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is methyl 3-(3-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(methylamino)propanoate.
| Compound Name | methyl 3-(3-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 107771732 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | methyl 3-(3-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(methylamino)propanoate |
| SMILES | CNC(C)(CSC(C)C(C)O)C(=O)OC |
| InChI | InChI=1S/C10H21NO3S/c1-7(12)8(2)15-6-10(3,11-4)9(13)14-5/h7-8,11-12H,6H2,1-5H3 |
| InChIKey | KLDYSUMDHZFREV-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |