C10H21NO3S — CID 107771793
2-(ethylamino)-3-(3-hydroxybutan-2-ylsulfanyl)-2-methylpropanoic acid (PubChem CID 107771793) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is 2-(ethylamino)-3-(3-hydroxybutan-2-ylsulfanyl)-2-methylpropanoic acid.
| Compound Name | 2-(ethylamino)-3-(3-hydroxybutan-2-ylsulfanyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 107771793 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-(ethylamino)-3-(3-hydroxybutan-2-ylsulfanyl)-2-methylpropanoic acid |
| SMILES | CCNC(C)(CSC(C)C(C)O)C(=O)O |
| InChI | InChI=1S/C10H21NO3S/c1-5-11-10(4,9(13)14)6-15-8(3)7(2)12/h7-8,11-12H,5-6H2,1-4H3,(H,13,14) |
| InChIKey | LBWZFVZOKFTGSB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |