C13H25NO3S — CID 107771845
2-cyclopropyl-3-(3-hydroxybutan-2-ylsulfanyl)-2-(propylamino)propanoic acid (PubChem CID 107771845) has the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. Its IUPAC name is 2-cyclopropyl-3-(3-hydroxybutan-2-ylsulfanyl)-2-(propylamino)propanoic acid.
| Compound Name | 2-cyclopropyl-3-(3-hydroxybutan-2-ylsulfanyl)-2-(propylamino)propanoic acid |
|---|---|
| PubChem CID | 107771845 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-cyclopropyl-3-(3-hydroxybutan-2-ylsulfanyl)-2-(propylamino)propanoic acid |
| SMILES | CCCNC(CSC(C)C(C)O)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C13H25NO3S/c1-4-7-14-13(12(16)17,11-5-6-11)8-18-10(3)9(2)15/h9-11,14-15H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | KOFKCNGCOSETMR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |