C16H22ClNO2S — CID 114791848
3-[(4-chlorophenyl)methylsulfanyl]-2-cyclopropyl-2-(propylamino)propanoic acid (PubChem CID 114791848) has the molecular formula C16H22ClNO2S and a molecular weight of 327.88 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylsulfanyl]-2-cyclopropyl-2-(propylamino)propanoic acid.
| Compound Name | 3-[(4-chlorophenyl)methylsulfanyl]-2-cyclopropyl-2-(propylamino)propanoic acid |
|---|---|
| PubChem CID | 114791848 |
| Molecular Formula | C16H22ClNO2S |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 3-[(4-chlorophenyl)methylsulfanyl]-2-cyclopropyl-2-(propylamino)propanoic acid |
| SMILES | CCCNC(CSCc1ccc(Cl)cc1)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C16H22ClNO2S/c1-2-9-18-16(15(19)20,13-5-6-13)11-21-10-12-3-7-14(17)8-4-12/h3-4,7-8,13,18H,2,5-6,9-11H2,1H3,(H,19,20) |
| InChIKey | LWZYIYGMOFDLSV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |