C14H19ClN2OS — CID 114791773
3-[(4-chlorophenyl)methylsulfanyl]-2-cyclopropyl-2-(methylamino)propanamide (PubChem CID 114791773) has the molecular formula C14H19ClN2OS and a molecular weight of 298.84 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylsulfanyl]-2-cyclopropyl-2-(methylamino)propanamide.
| Compound Name | 3-[(4-chlorophenyl)methylsulfanyl]-2-cyclopropyl-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 114791773 |
| Molecular Formula | C14H19ClN2OS |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 3-[(4-chlorophenyl)methylsulfanyl]-2-cyclopropyl-2-(methylamino)propanamide |
| SMILES | CNC(CSCc1ccc(Cl)cc1)(C(N)=O)C1CC1 |
| InChI | InChI=1S/C14H19ClN2OS/c1-17-14(13(16)18,11-4-5-11)9-19-8-10-2-6-12(15)7-3-10/h2-3,6-7,11,17H,4-5,8-9H2,1H3,(H2,16,18) |
| InChIKey | KBMJDKCLSPPLBC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |