C16H24ClNO2S — CID 114791654
methyl 4-[(4-chlorophenyl)methylsulfanyl]-2-methyl-2-(propylamino)butanoate (PubChem CID 114791654) has the molecular formula C16H24ClNO2S and a molecular weight of 329.89 g/mol. Its IUPAC name is methyl 4-[(4-chlorophenyl)methylsulfanyl]-2-methyl-2-(propylamino)butanoate.
| Compound Name | methyl 4-[(4-chlorophenyl)methylsulfanyl]-2-methyl-2-(propylamino)butanoate |
|---|---|
| PubChem CID | 114791654 |
| Molecular Formula | C16H24ClNO2S |
| Molecular Weight | 329.89 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | methyl 4-[(4-chlorophenyl)methylsulfanyl]-2-methyl-2-(propylamino)butanoate |
| SMILES | CCCNC(C)(CCSCc1ccc(Cl)cc1)C(=O)OC |
| InChI | InChI=1S/C16H24ClNO2S/c1-4-10-18-16(2,15(19)20-3)9-11-21-12-13-5-7-14(17)8-6-13/h5-8,18H,4,9-12H2,1-3H3 |
| InChIKey | VFFDHGBQARYYSN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.89 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|