C13H24F2N2O3 — CID 57285169
tert-butyl 2,5-diamino-4,4-difluoro-2-(2-methylpropyl)-3-oxopentanoate (PubChem CID 57285169) has the molecular formula C13H24F2N2O3 and a molecular weight of 294.34 g/mol. Its IUPAC name is tert-butyl 2,5-diamino-4,4-difluoro-2-(2-methylpropyl)-3-oxopentanoate.
| Compound Name | tert-butyl 2,5-diamino-4,4-difluoro-2-(2-methylpropyl)-3-oxopentanoate |
|---|---|
| PubChem CID | 57285169 |
| Molecular Formula | C13H24F2N2O3 |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | tert-butyl 2,5-diamino-4,4-difluoro-2-(2-methylpropyl)-3-oxopentanoate |
| SMILES | CC(C)CC(N)(C(=O)OC(C)(C)C)C(=O)C(F)(F)CN |
| InChI | InChI=1S/C13H24F2N2O3/c1-8(2)6-12(17,9(18)13(14,15)7-16)10(19)20-11(3,4)5/h8H,6-7,16-17H2,1-5H3 |
| InChIKey | MXCSFHATWNKGKZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|