C12H28N2O7P2 — CID 134929357
2-amino-4,4-bis(diethoxyphosphoryl)butanamide (PubChem CID 134929357) has the molecular formula C12H28N2O7P2 and a molecular weight of 374.31 g/mol. Its IUPAC name is 2-amino-4,4-bis(diethoxyphosphoryl)butanamide.
| Compound Name | 2-amino-4,4-bis(diethoxyphosphoryl)butanamide |
|---|---|
| PubChem CID | 134929357 |
| Molecular Formula | C12H28N2O7P2 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-amino-4,4-bis(diethoxyphosphoryl)butanamide |
| SMILES | CCOP(=O)(OCC)C(CC(N)C(N)=O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C12H28N2O7P2/c1-5-18-22(16,19-6-2)11(9-10(13)12(14)15)23(17,20-7-3)21-8-4/h10-11H,5-9,13H2,1-4H3,(H2,14,15) |
| InChIKey | GRMPJVAYBVUETJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 140.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|