C8H18N3O5P — CID 3706714
2-diethoxyphosphoryl-2-(methylcarbamoylamino)acetamide (PubChem CID 3706714) has the molecular formula C8H18N3O5P and a molecular weight of 267.22 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-2-(methylcarbamoylamino)acetamide.
| Compound Name | 2-diethoxyphosphoryl-2-(methylcarbamoylamino)acetamide |
|---|---|
| PubChem CID | 3706714 |
| Molecular Formula | C8H18N3O5P |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-diethoxyphosphoryl-2-(methylcarbamoylamino)acetamide |
| SMILES | CCOP(=O)(OCC)C(NC(=O)NC)C(N)=O |
| InChI | InChI=1S/C8H18N3O5P/c1-4-15-17(14,16-5-2)7(6(9)12)11-8(13)10-3/h7H,4-5H2,1-3H3,(H2,9,12)(H2,10,11,13) |
| InChIKey | SIKXCFPYQOTUQO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|