C10H22NO4P — CID 118391289
N-(1-diethoxyphosphorylethyl)-2-methylpropanamide (PubChem CID 118391289) has the molecular formula C10H22NO4P and a molecular weight of 251.26 g/mol. Its IUPAC name is N-(1-diethoxyphosphorylethyl)-2-methylpropanamide.
| Compound Name | N-(1-diethoxyphosphorylethyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 118391289 |
| Molecular Formula | C10H22NO4P |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-(1-diethoxyphosphorylethyl)-2-methylpropanamide |
| SMILES | CCOP(=O)(OCC)C(C)NC(=O)C(C)C |
| InChI | InChI=1S/C10H22NO4P/c1-6-14-16(13,15-7-2)9(5)11-10(12)8(3)4/h8-9H,6-7H2,1-5H3,(H,11,12) |
| InChIKey | GNZWBEZXXAVJFP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|