C15H29ClN3O7PS — CID 175067456
[(2S)-1-[[(2R)-3-chloro-1-(1-diethoxyphosphorylethylamino)-1-oxopropan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl] carbamate (PubChem CID 175067456) has the molecular formula C15H29ClN3O7PS and a molecular weight of 461.91 g/mol. Its IUPAC name is [(2S)-1-[[(2R)-3-chloro-1-(1-diethoxyphosphorylethylamino)-1-oxopropan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl] carbamate.
| Compound Name | [(2S)-1-[[(2R)-3-chloro-1-(1-diethoxyphosphorylethylamino)-1-oxopropan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl] carbamate |
|---|---|
| PubChem CID | 175067456 |
| Molecular Formula | C15H29ClN3O7PS |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | [(2S)-1-[[(2R)-3-chloro-1-(1-diethoxyphosphorylethylamino)-1-oxopropan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl] carbamate |
| SMILES | CCOP(=O)(OCC)C(C)NC(=O)[C@H](CCl)NC(=O)[C@H](CCSC)OC(N)=O |
| InChI | InChI=1S/C15H29ClN3O7PS/c1-5-24-27(23,25-6-2)10(3)18-13(20)11(9-16)19-14(21)12(7-8-28-4)26-15(17)22/h10-12H,5-9H2,1-4H3,(H2,17,22)(H,18,20)(H,19,21)/t10?,11-,12-/m0/s1 |
| InChIKey | VDBDLWBUPXWDNZ-RAMGSTBQSA-N |
| XLogP | 1.66 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|