C10H20ClN2O6P — CID 175065435
[(2R)-3-chloro-1-(1-diethoxyphosphorylethylamino)-1-oxopropan-2-yl] carbamate (PubChem CID 175065435) has the molecular formula C10H20ClN2O6P and a molecular weight of 330.71 g/mol. Its IUPAC name is [(2R)-3-chloro-1-(1-diethoxyphosphorylethylamino)-1-oxopropan-2-yl] carbamate.
| Compound Name | [(2R)-3-chloro-1-(1-diethoxyphosphorylethylamino)-1-oxopropan-2-yl] carbamate |
|---|---|
| PubChem CID | 175065435 |
| Molecular Formula | C10H20ClN2O6P |
| Molecular Weight | 330.71 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | [(2R)-3-chloro-1-(1-diethoxyphosphorylethylamino)-1-oxopropan-2-yl] carbamate |
| SMILES | CCOP(=O)(OCC)C(C)NC(=O)[C@H](CCl)OC(N)=O |
| InChI | InChI=1S/C10H20ClN2O6P/c1-4-17-20(16,18-5-2)7(3)13-9(14)8(6-11)19-10(12)15/h7-8H,4-6H2,1-3H3,(H2,12,15)(H,13,14)/t7?,8-/m0/s1 |
| InChIKey | XLJOEMCWKLXOCX-MQWKRIRWSA-N |
| XLogP | 1.42 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.71 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|