C9H17Cl2O5P — CID 11426764
[(1R,2S)-1-chloro-1-diethoxyphosphorylpropan-2-yl] 2-chloroacetate (PubChem CID 11426764) has the molecular formula C9H17Cl2O5P and a molecular weight of 307.11 g/mol. Its IUPAC name is [(1R,2S)-1-chloro-1-diethoxyphosphorylpropan-2-yl] 2-chloroacetate.
| Compound Name | [(1R,2S)-1-chloro-1-diethoxyphosphorylpropan-2-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 11426764 |
| Molecular Formula | C9H17Cl2O5P |
| Molecular Weight | 307.11 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | [(1R,2S)-1-chloro-1-diethoxyphosphorylpropan-2-yl] 2-chloroacetate |
| SMILES | CCOP(=O)(OCC)[C@H](Cl)[C@H](C)OC(=O)CCl |
| InChI | InChI=1S/C9H17Cl2O5P/c1-4-14-17(13,15-5-2)9(11)7(3)16-8(12)6-10/h7,9H,4-6H2,1-3H3/t7-,9-/m0/s1 |
| InChIKey | JUPMQHWHPATWIF-CBAPKCEASA-N |
| XLogP | 2.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.11 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|