About [(1R)-5-chloro-1-di(propan-2-yloxy)phosphorylpentyl] 2-chloroacetate
[(1R)-5-chloro-1-di(propan-2-yloxy)phosphorylpentyl] 2-chloroacetate (PubChem CID 53355774) has the molecular formula C13H25Cl2O5P
and a molecular weight of 363.22 g/mol. Its IUPAC name is [(1R)-5-chloro-1-di(propan-2-yloxy)phosphorylpentyl] 2-chloroacetate.
Molecular Properties
| Compound Name | [(1R)-5-chloro-1-di(propan-2-yloxy)phosphorylpentyl] 2-chloroacetate |
| PubChem CID | 53355774 |
| Molecular Formula | C13H25Cl2O5P |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | [(1R)-5-chloro-1-di(propan-2-yloxy)phosphorylpentyl] 2-chloroacetate |
| SMILES | CC(C)OP(=O)(OC(C)C)[C@H](CCCCCl)OC(=O)CCl |
| InChI | InChI=1S/C13H25Cl2O5P/c1-10(2)19-21(17,20-11(3)4)13(7-5-6-8-14)18-12(16)9-15/h10-11,13H,5-9H2,1-4H3/t13-/m1/s1 |
| InChIKey | ZODJDIQXQAVKHB-CYBMUJFWSA-N |
| XLogP | 4.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-5-chloro-1-di(propan-2-yloxy)phosphorylpentyl] 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-5-chloro-1-di(propan-2-yloxy)phosphorylpentyl] 2-chloroacetate?
The IUPAC name of [(1R)-5-chloro-1-di(propan-2-yloxy)phosphorylpentyl] 2-chloroacetate (CID 53355774) is [(1R)-5-chloro-1-di(propan-2-yloxy)phosphorylpentyl] 2-chloroacetate.
What is the SMILES notation for [(1R)-5-chloro-1-di(propan-2-yloxy)phosphorylpentyl] 2-chloroacetate?
The canonical SMILES for [(1R)-5-chloro-1-di(propan-2-yloxy)phosphorylpentyl] 2-chloroacetate is CC(C)OP(=O)(OC(C)C)[C@H](CCCCCl)OC(=O)CCl.
What is the InChIKey of [(1R)-5-chloro-1-di(propan-2-yloxy)phosphorylpentyl] 2-chloroacetate?
The InChIKey is ZODJDIQXQAVKHB-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H25Cl2O5P/c1-10(2)19-21(17,20-11(3)4)13(7-5-6-8-14)18-12(16)9-15/h10-11,13H,5-9H2,1-4H3/t13-/m1/s1.
What are the key properties of [(1R)-5-chloro-1-di(propan-2-yloxy)phosphorylpentyl] 2-chloroacetate?
[(1R)-5-chloro-1-di(propan-2-yloxy)phosphorylpentyl] 2-chloroacetate has a molecular weight of 363.22 g/mol, XLogP of 4.55, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-5-chloro-1-di(propan-2-yloxy)phosphorylpentyl] 2-chloroacetate is sourced from PubChem (CID 53355774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).